C26H16I8O9S — CID 177131549
4-[2,2-bis[(2,4,6-triiodobenzoyl)oxymethyl]butanoyloxy]-2,6-diiodobenzenesulfonic acid (PubChem CID 177131549) has the molecular formula C26H16I8O9S and a molecular weight of 1519.70 g/mol. Its IUPAC name is 4-[2,2-bis[(2,4,6-triiodobenzoyl)oxymethyl]butanoyloxy]-2,6-diiodobenzenesulfonic acid.
| Compound Name | 4-[2,2-bis[(2,4,6-triiodobenzoyl)oxymethyl]butanoyloxy]-2,6-diiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131549 |
| Molecular Formula | C26H16I8O9S |
| Molecular Weight | 1519.70 g/mol |
| Exact Mass | 1519.29 |
| IUPAC Name | 4-[2,2-bis[(2,4,6-triiodobenzoyl)oxymethyl]butanoyloxy]-2,6-diiodobenzenesulfonic acid |
| SMILES | CCC(COC(=O)c1c(I)cc(I)cc1I)(COC(=O)c1c(I)cc(I)cc1I)C(=O)Oc1cc(I)c(S(=O)(=O)O)c(I)c1 |
| InChI | InChI=1S/C26H16I8O9S/c1-2-26(9-41-23(35)20-14(29)3-11(27)4-15(20)30,10-42-24(36)21-16(31)5-12(28)6-17(21)32)25(37)43-13-7-18(33)22(19(34)8-13)44(38,39)40/h3-8H,2,9-10H2,1H3,(H,38,39,40) |
| InChIKey | HSBJWFKAIWUNGS-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1519.70 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|