C20H3F5I6O7S — CID 177131637
2,6-diiodo-4-[2,3,4,5-tetraiodo-6-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoyl]oxybenzenesulfonic acid (PubChem CID 177131637) has the molecular formula C20H3F5I6O7S and a molecular weight of 1243.72 g/mol. Its IUPAC name is 2,6-diiodo-4-[2,3,4,5-tetraiodo-6-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoyl]oxybenzenesulfonic acid.
| Compound Name | 2,6-diiodo-4-[2,3,4,5-tetraiodo-6-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177131637 |
| Molecular Formula | C20H3F5I6O7S |
| Molecular Weight | 1243.72 g/mol |
| Exact Mass | 1243.38 |
| IUPAC Name | 2,6-diiodo-4-[2,3,4,5-tetraiodo-6-(2,3,4,5,6-pentafluorophenoxy)carbonylbenzoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1cc(I)c(S(=O)(=O)O)c(I)c1)c1c(I)c(I)c(I)c(I)c1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H3F5I6O7S/c21-8-9(22)11(24)17(12(25)10(8)23)38-20(33)7-6(13(28)15(30)16(31)14(7)29)19(32)37-3-1-4(26)18(5(27)2-3)39(34,35)36/h1-2H,(H,34,35,36) |
| InChIKey | LJCRWLKSSMKIEE-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1243.72 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|