C13H3F4I3O6S — CID 177131881
2,4,6-triiodo-3-(2,3,4,5-tetrafluoro-6-hydroxybenzoyl)oxybenzenesulfonic acid (PubChem CID 177131881) has the molecular formula C13H3F4I3O6S and a molecular weight of 743.93 g/mol. Its IUPAC name is 2,4,6-triiodo-3-(2,3,4,5-tetrafluoro-6-hydroxybenzoyl)oxybenzenesulfonic acid.
| Compound Name | 2,4,6-triiodo-3-(2,3,4,5-tetrafluoro-6-hydroxybenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177131881 |
| Molecular Formula | C13H3F4I3O6S |
| Molecular Weight | 743.93 g/mol |
| Exact Mass | 743.67 |
| IUPAC Name | 2,4,6-triiodo-3-(2,3,4,5-tetrafluoro-6-hydroxybenzoyl)oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(I)cc(I)c(S(=O)(=O)O)c1I)c1c(O)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H3F4I3O6S/c14-5-4(10(21)8(17)7(16)6(5)15)13(22)26-11-2(18)1-3(19)12(9(11)20)27(23,24)25/h1,21H,(H,23,24,25) |
| InChIKey | XVLNTQMYSXQKAS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|