C19H12I3NO8S2 — CID 177131311
3-[4-(benzenesulfonamido)-2-hydroxybenzoyl]oxy-2,4,6-triiodobenzenesulfonic acid (PubChem CID 177131311) has the molecular formula C19H12I3NO8S2 and a molecular weight of 827.15 g/mol. Its IUPAC name is 3-[4-(benzenesulfonamido)-2-hydroxybenzoyl]oxy-2,4,6-triiodobenzenesulfonic acid.
| Compound Name | 3-[4-(benzenesulfonamido)-2-hydroxybenzoyl]oxy-2,4,6-triiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131311 |
| Molecular Formula | C19H12I3NO8S2 |
| Molecular Weight | 827.15 g/mol |
| Exact Mass | 826.71 |
| IUPAC Name | 3-[4-(benzenesulfonamido)-2-hydroxybenzoyl]oxy-2,4,6-triiodobenzenesulfonic acid |
| SMILES | O=C(Oc1c(I)cc(I)c(S(=O)(=O)O)c1I)c1ccc(NS(=O)(=O)c2ccccc2)cc1O |
| InChI | InChI=1S/C19H12I3NO8S2/c20-13-9-14(21)18(33(28,29)30)16(22)17(13)31-19(25)12-7-6-10(8-15(12)24)23-32(26,27)11-4-2-1-3-5-11/h1-9,23-24H,(H,28,29,30) |
| InChIKey | RQGGXXBBVNWMQR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.15 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|