C28H23NO5S — CID 2956443
N-[4-hydroxy-3-[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 2956443) has the molecular formula C28H23NO5S and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[4-hydroxy-3-[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-hydroxy-3-[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2956443 |
| Molecular Formula | C28H23NO5S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[4-hydroxy-3-[(Z)-1-hydroxy-3-oxo-1,3-diphenylprop-1-en-2-yl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(O)c(/C(C(=O)c3ccccc3)=C(/O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H23NO5S/c1-19-12-15-23(16-13-19)35(33,34)29-22-14-17-25(30)24(18-22)26(27(31)20-8-4-2-5-9-20)28(32)21-10-6-3-7-11-21/h2-18,29-31H,1H3/b27-26- |
| InChIKey | MRPGNTBZVTUVNN-RQZHXJHFSA-N |
| XLogP | 5.81 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|