C8H4FI3O5S — CID 177131684
3-acetyloxy-5-fluoro-2,4,6-triiodobenzenesulfonic acid (PubChem CID 177131684) has the molecular formula C8H4FI3O5S and a molecular weight of 611.89 g/mol. Its IUPAC name is 3-acetyloxy-5-fluoro-2,4,6-triiodobenzenesulfonic acid.
| Compound Name | 3-acetyloxy-5-fluoro-2,4,6-triiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131684 |
| Molecular Formula | C8H4FI3O5S |
| Molecular Weight | 611.89 g/mol |
| Exact Mass | 611.69 |
| IUPAC Name | 3-acetyloxy-5-fluoro-2,4,6-triiodobenzenesulfonic acid |
| SMILES | CC(=O)Oc1c(I)c(F)c(I)c(S(=O)(=O)O)c1I |
| InChI | InChI=1S/C8H4FI3O5S/c1-2(13)17-7-4(10)3(9)5(11)8(6(7)12)18(14,15)16/h1H3,(H,14,15,16) |
| InChIKey | VSZURAAPOOTMIM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|