C16H8F6O9S2 — CID 161278537
3,4,5-trifluoro-2-methyl-6-(2,3,4-trifluoro-5-methyl-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid (PubChem CID 161278537) has the molecular formula C16H8F6O9S2 and a molecular weight of 522.35 g/mol. Its IUPAC name is 3,4,5-trifluoro-2-methyl-6-(2,3,4-trifluoro-5-methyl-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid.
| Compound Name | 3,4,5-trifluoro-2-methyl-6-(2,3,4-trifluoro-5-methyl-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 161278537 |
| Molecular Formula | C16H8F6O9S2 |
| Molecular Weight | 522.35 g/mol |
| Exact Mass | 521.95 |
| IUPAC Name | 3,4,5-trifluoro-2-methyl-6-(2,3,4-trifluoro-5-methyl-6-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
| SMILES | Cc1c(F)c(F)c(F)c(C(=O)OC(=O)c2c(F)c(F)c(F)c(C)c2S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C16H8F6O9S2/c1-3-7(17)11(21)9(19)5(13(3)32(25,26)27)15(23)31-16(24)6-10(20)12(22)8(18)4(2)14(6)33(28,29)30/h1-2H3,(H,25,26,27)(H,28,29,30) |
| InChIKey | VETMUYLFFGTZBX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|