C9H5F5O5S — CID 129061781
2-(2,3,4,5,6-pentafluorobenzoyl)oxyethanesulfonic acid (PubChem CID 129061781) has the molecular formula C9H5F5O5S and a molecular weight of 320.19 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorobenzoyl)oxyethanesulfonic acid.
| Compound Name | 2-(2,3,4,5,6-pentafluorobenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 129061781 |
| Molecular Formula | C9H5F5O5S |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorobenzoyl)oxyethanesulfonic acid |
| SMILES | O=C(OCCS(=O)(=O)O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F5O5S/c10-4-3(5(11)7(13)8(14)6(4)12)9(15)19-1-2-20(16,17)18/h1-2H2,(H,16,17,18) |
| InChIKey | PQHKPQFNTUQTLQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|