C7H8O5S2 — CID 129061901
2-(thiophene-3-carbonyloxy)ethanesulfonic acid (PubChem CID 129061901) has the molecular formula C7H8O5S2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(thiophene-3-carbonyloxy)ethanesulfonic acid.
| Compound Name | 2-(thiophene-3-carbonyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 129061901 |
| Molecular Formula | C7H8O5S2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 2-(thiophene-3-carbonyloxy)ethanesulfonic acid |
| SMILES | O=C(OCCS(=O)(=O)O)c1ccsc1 |
| InChI | InChI=1S/C7H8O5S2/c8-7(6-1-3-13-5-6)12-2-4-14(9,10)11/h1,3,5H,2,4H2,(H,9,10,11) |
| InChIKey | SNPPBZZLIDXSHP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|