C17H26O6S — CID 161134814
2-(3,5-ditert-butyl-4-hydroxybenzoyl)oxyethanesulfonic acid (PubChem CID 161134814) has the molecular formula C17H26O6S and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-hydroxybenzoyl)oxyethanesulfonic acid.
| Compound Name | 2-(3,5-ditert-butyl-4-hydroxybenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 161134814 |
| Molecular Formula | C17H26O6S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-hydroxybenzoyl)oxyethanesulfonic acid |
| SMILES | CC(C)(C)c1cc(C(=O)OCCS(=O)(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H26O6S/c1-16(2,3)12-9-11(10-13(14(12)18)17(4,5)6)15(19)23-7-8-24(20,21)22/h9-10,18H,7-8H2,1-6H3,(H,20,21,22) |
| InChIKey | NXKIVHNSUKFWRH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|