C19H29BrO3 — CID 20658701
4-bromobutyl 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 20658701) has the molecular formula C19H29BrO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-bromobutyl 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | 4-bromobutyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 20658701 |
| Molecular Formula | C19H29BrO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-bromobutyl 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)OCCCCBr)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H29BrO3/c1-18(2,3)14-11-13(17(22)23-10-8-7-9-20)12-15(16(14)21)19(4,5)6/h11-12,21H,7-10H2,1-6H3 |
| InChIKey | OLDSNXULZKICSD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|