C18H25NO3 — CID 3806115
2-cyanoethyl 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 3806115) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-cyanoethyl 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | 2-cyanoethyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 3806115 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-cyanoethyl 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)OCCC#N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H25NO3/c1-17(2,3)13-10-12(16(21)22-9-7-8-19)11-14(15(13)20)18(4,5)6/h10-11,20H,7,9H2,1-6H3 |
| InChIKey | PARUSZDFMYJCBX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|