C51H60BNO3 — CID 22372528
benzyl-[3-(3,5-ditert-butyl-4-hydroxybenzoyl)oxypropyl]-dimethylazanium;tetraphenylboranuide (PubChem CID 22372528) has the molecular formula C51H60BNO3 and a molecular weight of 745.86 g/mol. Its IUPAC name is benzyl-[3-(3,5-ditert-butyl-4-hydroxybenzoyl)oxypropyl]-dimethylazanium;tetraphenylboranuide.
| Compound Name | benzyl-[3-(3,5-ditert-butyl-4-hydroxybenzoyl)oxypropyl]-dimethylazanium;tetraphenylboranuide |
|---|---|
| PubChem CID | 22372528 |
| Molecular Formula | C51H60BNO3 |
| Molecular Weight | 745.86 g/mol |
| Exact Mass | 745.47 |
| IUPAC Name | benzyl-[3-(3,5-ditert-butyl-4-hydroxybenzoyl)oxypropyl]-dimethylazanium;tetraphenylboranuide |
| SMILES | CC(C)(C)c1cc(C(=O)OCCC[N+](C)(C)Cc2ccccc2)cc(C(C)(C)C)c1O.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H39NO3.C24H20B/c1-26(2,3)22-17-21(18-23(24(22)29)27(4,5)6)25(30)31-16-12-15-28(7,8)19-20-13-10-9-11-14-20;1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h9-11,13-14,17-18H,12,15-16,19H2,1-8H3;1-20H/q;-1/p+1 |
| InChIKey | VLNCLTDRJLTTSR-UHFFFAOYSA-O |
| XLogP | 8.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.86 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|