C21H34NO2+ — CID 139823019
benzyl-dimethyl-[8-(2-methylprop-2-enoyloxy)octyl]azanium (PubChem CID 139823019) has the molecular formula C21H34NO2+ and a molecular weight of 332.51 g/mol. Its IUPAC name is benzyl-dimethyl-[8-(2-methylprop-2-enoyloxy)octyl]azanium.
| Compound Name | benzyl-dimethyl-[8-(2-methylprop-2-enoyloxy)octyl]azanium |
|---|---|
| PubChem CID | 139823019 |
| Molecular Formula | C21H34NO2+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | benzyl-dimethyl-[8-(2-methylprop-2-enoyloxy)octyl]azanium |
| SMILES | C=C(C)C(=O)OCCCCCCCC[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H34NO2/c1-19(2)21(23)24-17-13-8-6-5-7-12-16-22(3,4)18-20-14-10-9-11-15-20/h9-11,14-15H,1,5-8,12-13,16-18H2,2-4H3/q+1 |
| InChIKey | OURLDOYGTJWWLJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|