C20H30ClNO4 — CID 87536903
benzyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-methylidenebutanoic acid;chloride (PubChem CID 87536903) has the molecular formula C20H30ClNO4 and a molecular weight of 383.92 g/mol. Its IUPAC name is benzyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-methylidenebutanoic acid;chloride.
| Compound Name | benzyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-methylidenebutanoic acid;chloride |
|---|---|
| PubChem CID | 87536903 |
| Molecular Formula | C20H30ClNO4 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | benzyl-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;2-methylidenebutanoic acid;chloride |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)Cc1ccccc1.C=C(CC)C(=O)O.[Cl-] |
| InChI | InChI=1S/C15H22NO2.C5H8O2.ClH/c1-13(2)15(17)18-11-10-16(3,4)12-14-8-6-5-7-9-14;1-3-4(2)5(6)7;/h5-9H,1,10-12H2,2-4H3;2-3H2,1H3,(H,6,7);1H/q+1;;/p-1 |
| InChIKey | YYWMFCJYFPHCOO-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|