C20H32ClNO2 — CID 87839799
benzyl-[3-(2-methylprop-2-enoyloxy)propyl]-dipropylazanium chloride (PubChem CID 87839799) has the molecular formula C20H32ClNO2 and a molecular weight of 353.93 g/mol. Its IUPAC name is benzyl-[3-(2-methylprop-2-enoyloxy)propyl]-dipropylazanium chloride.
| Compound Name | benzyl-[3-(2-methylprop-2-enoyloxy)propyl]-dipropylazanium chloride |
|---|---|
| PubChem CID | 87839799 |
| Molecular Formula | C20H32ClNO2 |
| Molecular Weight | 353.93 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | benzyl-[3-(2-methylprop-2-enoyloxy)propyl]-dipropylazanium chloride |
| SMILES | C=C(C)C(=O)OCCC[N+](CCC)(CCC)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H32NO2.ClH/c1-5-13-21(14-6-2,17-19-11-8-7-9-12-19)15-10-16-23-20(22)18(3)4;/h7-9,11-12H,3,5-6,10,13-17H2,1-2,4H3;1H/q+1;/p-1 |
| InChIKey | NMFGARDTLDUJRE-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.93 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|