C26H38Br2N2O4 — CID 18528273
benzyl-[2-[4-[2-[benzyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium dibromide (PubChem CID 18528273) has the molecular formula C26H38Br2N2O4 and a molecular weight of 602.41 g/mol. Its IUPAC name is benzyl-[2-[4-[2-[benzyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium dibromide.
| Compound Name | benzyl-[2-[4-[2-[benzyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 18528273 |
| Molecular Formula | C26H38Br2N2O4 |
| Molecular Weight | 602.41 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | benzyl-[2-[4-[2-[benzyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium dibromide |
| SMILES | C[N+](C)(CCOC(=O)CCC(=O)OCC[N+](C)(C)Cc1ccccc1)Cc1ccccc1.[Br-].[Br-] |
| InChI | InChI=1S/C26H38N2O4.2BrH/c1-27(2,21-23-11-7-5-8-12-23)17-19-31-25(29)15-16-26(30)32-20-18-28(3,4)22-24-13-9-6-10-14-24;;/h5-14H,15-22H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | OFWSDQPCLVEYJN-UHFFFAOYSA-L |
| XLogP | -2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.41 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|