C16H24INO2 — CID 141315122
benzyl-dimethyl-(4-prop-2-enoyloxybutyl)azanium iodide (PubChem CID 141315122) has the molecular formula C16H24INO2 and a molecular weight of 389.28 g/mol. Its IUPAC name is benzyl-dimethyl-(4-prop-2-enoyloxybutyl)azanium iodide.
| Compound Name | benzyl-dimethyl-(4-prop-2-enoyloxybutyl)azanium iodide |
|---|---|
| PubChem CID | 141315122 |
| Molecular Formula | C16H24INO2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | benzyl-dimethyl-(4-prop-2-enoyloxybutyl)azanium iodide |
| SMILES | C=CC(=O)OCCCC[N+](C)(C)Cc1ccccc1.[I-] |
| InChI | InChI=1S/C16H24NO2.HI/c1-4-16(18)19-13-9-8-12-17(2,3)14-15-10-6-5-7-11-15;/h4-7,10-11H,1,8-9,12-14H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | CWGCHLJLEYYEKJ-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|