C19H32N2O2+2 — CID 18413289
[4-[[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]methyl]phenyl]methyl-ethyl-dimethylazanium (PubChem CID 18413289) has the molecular formula C19H32N2O2+2 and a molecular weight of 320.48 g/mol. Its IUPAC name is [4-[[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]methyl]phenyl]methyl-ethyl-dimethylazanium.
| Compound Name | [4-[[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]methyl]phenyl]methyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 18413289 |
| Molecular Formula | C19H32N2O2+2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | [4-[[dimethyl(2-prop-2-enoyloxyethyl)azaniumyl]methyl]phenyl]methyl-ethyl-dimethylazanium |
| SMILES | C=CC(=O)OCC[N+](C)(C)Cc1ccc(C[N+](C)(C)CC)cc1 |
| InChI | InChI=1S/C19H32N2O2/c1-7-19(22)23-14-13-21(5,6)16-18-11-9-17(10-12-18)15-20(3,4)8-2/h7,9-12H,1,8,13-16H2,2-6H3/q+2 |
| InChIKey | RLZMJEZVUIHSOG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|