C22H26BrNO4 — CID 86744146
[4-(4-methoxybenzoyl)phenyl]methyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium bromide (PubChem CID 86744146) has the molecular formula C22H26BrNO4 and a molecular weight of 448.36 g/mol. Its IUPAC name is [4-(4-methoxybenzoyl)phenyl]methyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium bromide.
| Compound Name | [4-(4-methoxybenzoyl)phenyl]methyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium bromide |
|---|---|
| PubChem CID | 86744146 |
| Molecular Formula | C22H26BrNO4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-(4-methoxybenzoyl)phenyl]methyl-dimethyl-(2-prop-2-enoyloxyethyl)azanium bromide |
| SMILES | C=CC(=O)OCC[N+](C)(C)Cc1ccc(C(=O)c2ccc(OC)cc2)cc1.[Br-] |
| InChI | InChI=1S/C22H26NO4.BrH/c1-5-21(24)27-15-14-23(2,3)16-17-6-8-18(9-7-17)22(25)19-10-12-20(26-4)13-11-19;/h5-13H,1,14-16H2,2-4H3;1H/q+1;/p-1 |
| InChIKey | ZSLHRKMOWUKGOH-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|