C22H28BrNO4 — CID 23037628
(4-methoxyphenyl)-phenylmethanone;trimethyl(2-prop-2-enoyloxyethyl)azanium;bromide (PubChem CID 23037628) has the molecular formula C22H28BrNO4 and a molecular weight of 450.37 g/mol. Its IUPAC name is (4-methoxyphenyl)-phenylmethanone;trimethyl(2-prop-2-enoyloxyethyl)azanium;bromide.
| Compound Name | (4-methoxyphenyl)-phenylmethanone;trimethyl(2-prop-2-enoyloxyethyl)azanium;bromide |
|---|---|
| PubChem CID | 23037628 |
| Molecular Formula | C22H28BrNO4 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (4-methoxyphenyl)-phenylmethanone;trimethyl(2-prop-2-enoyloxyethyl)azanium;bromide |
| SMILES | C=CC(=O)OCC[N+](C)(C)C.COc1ccc(C(=O)c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C14H12O2.C8H16NO2.BrH/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11;1-5-8(10)11-7-6-9(2,3)4;/h2-10H,1H3;5H,1,6-7H2,2-4H3;1H/q;+1;/p-1 |
| InChIKey | HUMHSUFBHLZVDN-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|