C15H21ClNO2+ — CID 141131616
(3-chlorophenyl)methyl-ethyl-methyl-(2-prop-2-enoyloxyethyl)azanium (PubChem CID 141131616) has the molecular formula C15H21ClNO2+ and a molecular weight of 282.79 g/mol. Its IUPAC name is (3-chlorophenyl)methyl-ethyl-methyl-(2-prop-2-enoyloxyethyl)azanium.
| Compound Name | (3-chlorophenyl)methyl-ethyl-methyl-(2-prop-2-enoyloxyethyl)azanium |
|---|---|
| PubChem CID | 141131616 |
| Molecular Formula | C15H21ClNO2+ |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (3-chlorophenyl)methyl-ethyl-methyl-(2-prop-2-enoyloxyethyl)azanium |
| SMILES | C=CC(=O)OCC[N+](C)(CC)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClNO2/c1-4-15(18)19-10-9-17(3,5-2)12-13-7-6-8-14(16)11-13/h4,6-8,11H,1,5,9-10,12H2,2-3H3/q+1 |
| InChIKey | JCHKPRXLVGCHCA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|