C17H25NO2 — CID 11780765
6-(N-methylanilino)hexyl 2-methylprop-2-enoate (PubChem CID 11780765) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 6-(N-methylanilino)hexyl 2-methylprop-2-enoate.
| Compound Name | 6-(N-methylanilino)hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11780765 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 6-(N-methylanilino)hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2/c1-15(2)17(19)20-14-10-5-4-9-13-18(3)16-11-7-6-8-12-16/h6-8,11-12H,1,4-5,9-10,13-14H2,2-3H3 |
| InChIKey | FWRIOIAKLLDKHL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|