C14H10F4O4 — CID 71338498
bis(prop-2-enyl) 2,4,5,6-tetrafluorobenzene-1,3-dicarboxylate (PubChem CID 71338498) has the molecular formula C14H10F4O4 and a molecular weight of 318.22 g/mol. Its IUPAC name is bis(prop-2-enyl) 2,4,5,6-tetrafluorobenzene-1,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 2,4,5,6-tetrafluorobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71338498 |
| Molecular Formula | C14H10F4O4 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | bis(prop-2-enyl) 2,4,5,6-tetrafluorobenzene-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)c1c(F)c(F)c(F)c(C(=O)OCC=C)c1F |
| InChI | InChI=1S/C14H10F4O4/c1-3-5-21-13(19)7-9(15)8(14(20)22-6-4-2)11(17)12(18)10(7)16/h3-4H,1-2,5-6H2 |
| InChIKey | NOPODQQHEWTJOP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|