C12H11F5O7S — CID 87347585
acetic acid;but-2-yne-1,4-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid (PubChem CID 87347585) has the molecular formula C12H11F5O7S and a molecular weight of 394.27 g/mol. Its IUPAC name is acetic acid;but-2-yne-1,4-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid.
| Compound Name | acetic acid;but-2-yne-1,4-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 87347585 |
| Molecular Formula | C12H11F5O7S |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | acetic acid;but-2-yne-1,4-diol;2,3,4,5,6-pentafluorobenzenesulfonic acid |
| SMILES | CC(=O)O.O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F.OCC#CCO |
| InChI | InChI=1S/C6HF5O3S.C4H6O2.C2H4O2/c7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9;5-3-1-2-4-6;1-2(3)4/h(H,12,13,14);5-6H,3-4H2;1H3,(H,3,4) |
| InChIKey | CPVVBPJKAAEXIV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|