C12H10F4O4S — CID 89308691
2,3,5,6-tetrafluoro-4-(3-methylbuta-1,3-dien-2-yloxymethyl)benzenesulfonic acid (PubChem CID 89308691) has the molecular formula C12H10F4O4S and a molecular weight of 326.27 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(3-methylbuta-1,3-dien-2-yloxymethyl)benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-(3-methylbuta-1,3-dien-2-yloxymethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89308691 |
| Molecular Formula | C12H10F4O4S |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(3-methylbuta-1,3-dien-2-yloxymethyl)benzenesulfonic acid |
| SMILES | C=C(C)C(=C)OCc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C12H10F4O4S/c1-5(2)6(3)20-4-7-8(13)10(15)12(21(17,18)19)11(16)9(7)14/h1,3-4H2,2H3,(H,17,18,19) |
| InChIKey | NBEUSFYSYZNSCI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|