C14H12F4O4 — CID 163645138
[2-oxo-2-[(2,3,4,5-tetrafluoro-6-methylphenyl)methoxy]ethyl] 2-methylprop-2-enoate (PubChem CID 163645138) has the molecular formula C14H12F4O4 and a molecular weight of 320.24 g/mol. Its IUPAC name is [2-oxo-2-[(2,3,4,5-tetrafluoro-6-methylphenyl)methoxy]ethyl] 2-methylprop-2-enoate.
| Compound Name | [2-oxo-2-[(2,3,4,5-tetrafluoro-6-methylphenyl)methoxy]ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163645138 |
| Molecular Formula | C14H12F4O4 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | [2-oxo-2-[(2,3,4,5-tetrafluoro-6-methylphenyl)methoxy]ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OCc1c(C)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H12F4O4/c1-6(2)14(20)22-5-9(19)21-4-8-7(3)10(15)12(17)13(18)11(8)16/h1,4-5H2,2-3H3 |
| InChIKey | IHPLLLYIRUHXAI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|