C19H23F4N3O2 — CID 176671586
9-(4-azido-2,3,5,6-tetrafluorophenyl)nonyl 2-methylprop-2-enoate (PubChem CID 176671586) has the molecular formula C19H23F4N3O2 and a molecular weight of 401.40 g/mol. Its IUPAC name is 9-(4-azido-2,3,5,6-tetrafluorophenyl)nonyl 2-methylprop-2-enoate.
| Compound Name | 9-(4-azido-2,3,5,6-tetrafluorophenyl)nonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 176671586 |
| Molecular Formula | C19H23F4N3O2 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 9-(4-azido-2,3,5,6-tetrafluorophenyl)nonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCc1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C19H23F4N3O2/c1-12(2)19(27)28-11-9-7-5-3-4-6-8-10-13-14(20)16(22)18(25-26-24)17(23)15(13)21/h1,3-11H2,2H3 |
| InChIKey | ZWTZPURQEPGXOY-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|