C20H30O5 — CID 177344521
10-(3,4,5-trihydroxyphenyl)decyl 2-methylprop-2-enoate (PubChem CID 177344521) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 10-(3,4,5-trihydroxyphenyl)decyl 2-methylprop-2-enoate.
| Compound Name | 10-(3,4,5-trihydroxyphenyl)decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177344521 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 10-(3,4,5-trihydroxyphenyl)decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C20H30O5/c1-15(2)20(24)25-12-10-8-6-4-3-5-7-9-11-16-13-17(21)19(23)18(22)14-16/h13-14,21-23H,1,3-12H2,2H3 |
| InChIKey | QYWPWVJZJKGJNN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|