C22H23NO4 — CID 118188364
4-(1-hydroxy-5-methyl-9-oxo-10H-acridin-3-yl)butyl 2-methylprop-2-enoate (PubChem CID 118188364) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-(1-hydroxy-5-methyl-9-oxo-10H-acridin-3-yl)butyl 2-methylprop-2-enoate.
| Compound Name | 4-(1-hydroxy-5-methyl-9-oxo-10H-acridin-3-yl)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118188364 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-(1-hydroxy-5-methyl-9-oxo-10H-acridin-3-yl)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCc1cc(O)c2c(=O)c3cccc(C)c3[nH]c2c1 |
| InChI | InChI=1S/C22H23NO4/c1-13(2)22(26)27-10-5-4-8-15-11-17-19(18(24)12-15)21(25)16-9-6-7-14(3)20(16)23-17/h6-7,9,11-12,24H,1,4-5,8,10H2,2-3H3,(H,23,25) |
| InChIKey | SBCDUMBOZPCABB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|