C17H12ClNO4 — CID 90051507
(5-chloro-1-hydroxy-9-oxo-10H-acridin-3-yl) 2-methylprop-2-enoate (PubChem CID 90051507) has the molecular formula C17H12ClNO4 and a molecular weight of 329.74 g/mol. Its IUPAC name is (5-chloro-1-hydroxy-9-oxo-10H-acridin-3-yl) 2-methylprop-2-enoate.
| Compound Name | (5-chloro-1-hydroxy-9-oxo-10H-acridin-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90051507 |
| Molecular Formula | C17H12ClNO4 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (5-chloro-1-hydroxy-9-oxo-10H-acridin-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(O)c2c(=O)c3cccc(Cl)c3[nH]c2c1 |
| InChI | InChI=1S/C17H12ClNO4/c1-8(2)17(22)23-9-6-12-14(13(20)7-9)16(21)10-4-3-5-11(18)15(10)19-12/h3-7,20H,1H2,2H3,(H,19,21) |
| InChIKey | ZBBUHJSSIMMVQX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|