C14H12O4Y2 — CID 59524605
(5,7-dihydroxynaphthalen-1-yl) 2-methylprop-2-enoate;bis(yttrium) (PubChem CID 59524605) has the molecular formula C14H12O4Y2 and a molecular weight of 422.06 g/mol. Its IUPAC name is (5,7-dihydroxynaphthalen-1-yl) 2-methylprop-2-enoate;bis(yttrium).
| Compound Name | (5,7-dihydroxynaphthalen-1-yl) 2-methylprop-2-enoate;bis(yttrium) |
|---|---|
| PubChem CID | 59524605 |
| Molecular Formula | C14H12O4Y2 |
| Molecular Weight | 422.06 g/mol |
| Exact Mass | 421.89 |
| IUPAC Name | (5,7-dihydroxynaphthalen-1-yl) 2-methylprop-2-enoate;bis(yttrium) |
| SMILES | C=C(C)C(=O)Oc1cccc2c(O)cc(O)cc12.[Y].[Y] |
| InChI | InChI=1S/C14H12O4.2Y/c1-8(2)14(17)18-13-5-3-4-10-11(13)6-9(15)7-12(10)16;;/h3-7,15-16H,1H2,2H3;; |
| InChIKey | IJJVQRZMWKHTNQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.06 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|