About (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium
(7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium (PubChem CID 59524574) has the molecular formula C14H12O3Y
and a molecular weight of 317.15 g/mol. Its IUPAC name is (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium.
Molecular Properties
| Compound Name | (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium |
| PubChem CID | 59524574 |
| Molecular Formula | C14H12O3Y |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium |
| SMILES | C=C(C)C(=O)Oc1cccc2ccc(O)cc12.[Y] |
| InChI | InChI=1S/C14H12O3.Y/c1-9(2)14(16)17-13-5-3-4-10-6-7-11(15)8-12(10)13;/h3-8,15H,1H2,2H3; |
| InChIKey | OQPQVLDEWYBUTA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium?
The IUPAC name of (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium (CID 59524574) is (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium.
What is the SMILES notation for (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium?
The canonical SMILES for (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium is C=C(C)C(=O)Oc1cccc2ccc(O)cc12.[Y].
What is the InChIKey of (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium?
The InChIKey is OQPQVLDEWYBUTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3.Y/c1-9(2)14(16)17-13-5-3-4-10-6-7-11(15)8-12(10)13;/h3-8,15H,1H2,2H3;.
What are the key properties of (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium?
(7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium has a molecular weight of 317.15 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate;yttrium is sourced from PubChem (CID 59524574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).