C10H7Cl2NO — CID 82269325
1-(2,7-dichloro-1H-indol-3-yl)ethanone (PubChem CID 82269325) has the molecular formula C10H7Cl2NO and a molecular weight of 228.08 g/mol. Its IUPAC name is 1-(2,7-dichloro-1H-indol-3-yl)ethanone.
| Compound Name | 1-(2,7-dichloro-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 82269325 |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 1-(2,7-dichloro-1H-indol-3-yl)ethanone |
| SMILES | CC(=O)c1c(Cl)[nH]c2c(Cl)cccc12 |
| InChI | InChI=1S/C10H7Cl2NO/c1-5(14)8-6-3-2-4-7(11)9(6)13-10(8)12/h2-4,13H,1H3 |
| InChIKey | JRDWINSCFGREDE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |