C15H13ClN2O2 — CID 110850474
7-chloro-N-(furan-2-ylmethyl)-2-methyl-1H-indole-3-carboxamide (PubChem CID 110850474) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 7-chloro-N-(furan-2-ylmethyl)-2-methyl-1H-indole-3-carboxamide.
| Compound Name | 7-chloro-N-(furan-2-ylmethyl)-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 110850474 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 7-chloro-N-(furan-2-ylmethyl)-2-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2c(Cl)cccc2c1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H13ClN2O2/c1-9-13(11-5-2-6-12(16)14(11)18-9)15(19)17-8-10-4-3-7-20-10/h2-7,18H,8H2,1H3,(H,17,19) |
| InChIKey | WLUUNFNUATUBBZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |