C12H14N2O2 — CID 110766123
N-(furan-2-ylmethyl)-2,5-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 110766123) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,5-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2,5-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 110766123 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,5-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccco2)c(C)[nH]1 |
| InChI | InChI=1S/C12H14N2O2/c1-8-6-11(9(2)14-8)12(15)13-7-10-4-3-5-16-10/h3-6,14H,7H2,1-2H3,(H,13,15) |
| InChIKey | BHAIPJLXYYSIIR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |