C12H9Br2NO2 — CID 114369742
2,5-dibromo-N-(furan-2-ylmethyl)benzamide (PubChem CID 114369742) has the molecular formula C12H9Br2NO2 and a molecular weight of 359.02 g/mol. Its IUPAC name is 2,5-dibromo-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2,5-dibromo-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 114369742 |
| Molecular Formula | C12H9Br2NO2 |
| Molecular Weight | 359.02 g/mol |
| Exact Mass | 356.90 |
| IUPAC Name | 2,5-dibromo-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccco1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H9Br2NO2/c13-8-3-4-11(14)10(6-8)12(16)15-7-9-2-1-5-17-9/h1-6H,7H2,(H,15,16) |
| InChIKey | IVAJFXQRWBJQNJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.02 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |