C12H13NO3 — CID 110697610
N-(furan-2-ylmethyl)-4,5-dimethylfuran-2-carboxamide (PubChem CID 110697610) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4,5-dimethylfuran-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4,5-dimethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 110697610 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-4,5-dimethylfuran-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccco2)oc1C |
| InChI | InChI=1S/C12H13NO3/c1-8-6-11(16-9(8)2)12(14)13-7-10-4-3-5-15-10/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | IEEGHOLBVGGZTH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |