C12H12ClNO — CID 82494396
1-(6-chloro-2,7-dimethyl-1H-indol-3-yl)ethanone (PubChem CID 82494396) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 1-(6-chloro-2,7-dimethyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-(6-chloro-2,7-dimethyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 82494396 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-(6-chloro-2,7-dimethyl-1H-indol-3-yl)ethanone |
| SMILES | CC(=O)c1c(C)[nH]c2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C12H12ClNO/c1-6-10(13)5-4-9-11(8(3)15)7(2)14-12(6)9/h4-5,14H,1-3H3 |
| InChIKey | QXSWGTVLTDISAW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |