C14H16ClNO — CID 82499106
4-(6-chloro-2,7-dimethyl-1H-indol-3-yl)butan-2-one (PubChem CID 82499106) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is 4-(6-chloro-2,7-dimethyl-1H-indol-3-yl)butan-2-one.
| Compound Name | 4-(6-chloro-2,7-dimethyl-1H-indol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 82499106 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-(6-chloro-2,7-dimethyl-1H-indol-3-yl)butan-2-one |
| SMILES | CC(=O)CCc1c(C)[nH]c2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C14H16ClNO/c1-8(17)4-5-11-10(3)16-14-9(2)13(15)7-6-12(11)14/h6-7,16H,4-5H2,1-3H3 |
| InChIKey | YTFCRFIEEPNSBB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|