C17H21ClO5 — CID 19359286
3-chloro-4-hydroxy-2-[6-(2-methylprop-2-enoyloxy)hexyl]benzoic acid (PubChem CID 19359286) has the molecular formula C17H21ClO5 and a molecular weight of 340.80 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-2-[6-(2-methylprop-2-enoyloxy)hexyl]benzoic acid.
| Compound Name | 3-chloro-4-hydroxy-2-[6-(2-methylprop-2-enoyloxy)hexyl]benzoic acid |
|---|---|
| PubChem CID | 19359286 |
| Molecular Formula | C17H21ClO5 |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-chloro-4-hydroxy-2-[6-(2-methylprop-2-enoyloxy)hexyl]benzoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCc1c(C(=O)O)ccc(O)c1Cl |
| InChI | InChI=1S/C17H21ClO5/c1-11(2)17(22)23-10-6-4-3-5-7-12-13(16(20)21)8-9-14(19)15(12)18/h8-9,19H,1,3-7,10H2,2H3,(H,20,21) |
| InChIKey | NIZXNUQFCQFANO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|