C13H11F5O2 — CID 88744529
2-(2,3,4,5,6-pentafluorophenyl)propyl 2-methylprop-2-enoate (PubChem CID 88744529) has the molecular formula C13H11F5O2 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)propyl 2-methylprop-2-enoate.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88744529 |
| Molecular Formula | C13H11F5O2 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H11F5O2/c1-5(2)13(19)20-4-6(3)7-8(14)10(16)12(18)11(17)9(7)15/h6H,1,4H2,2-3H3 |
| InChIKey | AOEUGYBZUOKWJO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|