C13H16O5 — CID 172597336
2-(3,4,5-trihydroxyphenyl)propyl 2-methylprop-2-enoate (PubChem CID 172597336) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-(3,4,5-trihydroxyphenyl)propyl 2-methylprop-2-enoate.
| Compound Name | 2-(3,4,5-trihydroxyphenyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172597336 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(3,4,5-trihydroxyphenyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H16O5/c1-7(2)13(17)18-6-8(3)9-4-10(14)12(16)11(15)5-9/h4-5,8,14-16H,1,6H2,2-3H3 |
| InChIKey | OLPVFHDRUKLJKN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|