C33H33NO2 — CID 166789153
2-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 166789153) has the molecular formula C33H33NO2 and a molecular weight of 475.63 g/mol. Its IUPAC name is 2-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166789153 |
| Molecular Formula | C33H33NO2 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)c1ccc(-c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H33NO2/c1-23(2)33(35)36-22-26(5)27-10-12-28(13-11-27)29-14-20-32(21-15-29)34(30-16-6-24(3)7-17-30)31-18-8-25(4)9-19-31/h6-21,26H,1,22H2,2-5H3 |
| InChIKey | WQSPLEDTCFMYTA-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|