C25H23FO4 — CID 161439354
2-[10-fluoro-7-(2-methylprop-2-enoyloxy)phenanthren-2-yl]propyl 2-methylprop-2-enoate (PubChem CID 161439354) has the molecular formula C25H23FO4 and a molecular weight of 406.45 g/mol. Its IUPAC name is 2-[10-fluoro-7-(2-methylprop-2-enoyloxy)phenanthren-2-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[10-fluoro-7-(2-methylprop-2-enoyloxy)phenanthren-2-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 161439354 |
| Molecular Formula | C25H23FO4 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[10-fluoro-7-(2-methylprop-2-enoyloxy)phenanthren-2-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)c1ccc2c(c1)c(F)cc1cc(OC(=O)C(=C)C)ccc12 |
| InChI | InChI=1S/C25H23FO4/c1-14(2)24(27)29-13-16(5)17-6-8-21-20-9-7-19(30-25(28)15(3)4)10-18(20)12-23(26)22(21)11-17/h6-12,16H,1,3,13H2,2,4-5H3 |
| InChIKey | VOJYKTTXLMXJLL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|