C22H18F8O7 — CID 162135595
[4-(acetyloxymethyl)-2,3,5,6-tetrafluorophenyl]methyl acetate;[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl acetate (PubChem CID 162135595) has the molecular formula C22H18F8O7 and a molecular weight of 546.36 g/mol. Its IUPAC name is [4-(acetyloxymethyl)-2,3,5,6-tetrafluorophenyl]methyl acetate;[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl acetate.
| Compound Name | [4-(acetyloxymethyl)-2,3,5,6-tetrafluorophenyl]methyl acetate;[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 162135595 |
| Molecular Formula | C22H18F8O7 |
| Molecular Weight | 546.36 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | [4-(acetyloxymethyl)-2,3,5,6-tetrafluorophenyl]methyl acetate;[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl acetate |
| SMILES | CC(=O)OCc1c(F)c(F)c(CO)c(F)c1F.CC(=O)OCc1c(F)c(F)c(COC(C)=O)c(F)c1F |
| InChI | InChI=1S/C12H10F4O4.C10H8F4O3/c1-5(17)19-3-7-9(13)11(15)8(4-20-6(2)18)12(16)10(7)14;1-4(16)17-3-6-9(13)7(11)5(2-15)8(12)10(6)14/h3-4H2,1-2H3;15H,2-3H2,1H3 |
| InChIKey | ZJFVVYMURBOQDF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|