C11H9F5O4 — CID 91727445
2-methoxyethyl (2,3,4,5,6-pentafluorophenyl)methyl carbonate (PubChem CID 91727445) has the molecular formula C11H9F5O4 and a molecular weight of 300.18 g/mol. Its IUPAC name is 2-methoxyethyl (2,3,4,5,6-pentafluorophenyl)methyl carbonate.
| Compound Name | 2-methoxyethyl (2,3,4,5,6-pentafluorophenyl)methyl carbonate |
|---|---|
| PubChem CID | 91727445 |
| Molecular Formula | C11H9F5O4 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-methoxyethyl (2,3,4,5,6-pentafluorophenyl)methyl carbonate |
| SMILES | COCCOC(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H9F5O4/c1-18-2-3-19-11(17)20-4-5-6(12)8(14)10(16)9(15)7(5)13/h2-4H2,1H3 |
| InChIKey | NOJKWOUVNYUXHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|