C14H16F4O3 — CID 174257779
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl pentanoate (PubChem CID 174257779) has the molecular formula C14H16F4O3 and a molecular weight of 308.27 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl pentanoate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl pentanoate |
|---|---|
| PubChem CID | 174257779 |
| Molecular Formula | C14H16F4O3 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl pentanoate |
| SMILES | CCCCC(=O)OCc1c(F)c(F)c(COC)c(F)c1F |
| InChI | InChI=1S/C14H16F4O3/c1-3-4-5-10(19)21-7-9-13(17)11(15)8(6-20-2)12(16)14(9)18/h3-7H2,1-2H3 |
| InChIKey | MRWBHTRMAAUCLO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|