C21H14F10O4 — CID 91727560
bis[(2,3,4,5,6-pentafluorophenyl)methyl] heptanedioate (PubChem CID 91727560) has the molecular formula C21H14F10O4 and a molecular weight of 520.32 g/mol. Its IUPAC name is bis[(2,3,4,5,6-pentafluorophenyl)methyl] heptanedioate.
| Compound Name | bis[(2,3,4,5,6-pentafluorophenyl)methyl] heptanedioate |
|---|---|
| PubChem CID | 91727560 |
| Molecular Formula | C21H14F10O4 |
| Molecular Weight | 520.32 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | bis[(2,3,4,5,6-pentafluorophenyl)methyl] heptanedioate |
| SMILES | O=C(CCCCCC(=O)OCc1c(F)c(F)c(F)c(F)c1F)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H14F10O4/c22-12-8(13(23)17(27)20(30)16(12)26)6-34-10(32)4-2-1-3-5-11(33)35-7-9-14(24)18(28)21(31)19(29)15(9)25/h1-7H2 |
| InChIKey | XRKNQGOJSWTELL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.32 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|