C15H12F5NO3 — CID 602291
(2,3,4,5,6-pentafluorophenyl)methyl 4-(5-methyl-1,2-oxazol-3-yl)butanoate (PubChem CID 602291) has the molecular formula C15H12F5NO3 and a molecular weight of 349.26 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 4-(5-methyl-1,2-oxazol-3-yl)butanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 4-(5-methyl-1,2-oxazol-3-yl)butanoate |
|---|---|
| PubChem CID | 602291 |
| Molecular Formula | C15H12F5NO3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 4-(5-methyl-1,2-oxazol-3-yl)butanoate |
| SMILES | Cc1cc(CCCC(=O)OCc2c(F)c(F)c(F)c(F)c2F)no1 |
| InChI | InChI=1S/C15H12F5NO3/c1-7-5-8(21-24-7)3-2-4-10(22)23-6-9-11(16)13(18)15(20)14(19)12(9)17/h5H,2-4,6H2,1H3 |
| InChIKey | WPGYRONTDMJFGT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|